Eri-B compound, eriocalyxin B
| Name | Eriocalyxin B | ||
| PubChem CID | 16202215 | ||
| Molecular Weight | 344.4g/mol | ||
| Synonyms |
Eri-B compound, eriocalyxin B |
||
| Formula | C₂₀H₂₄O₅ | ||
| SMILES | CC1(C=CC(=O)C23C1C(C(C45C2CCC(C4)C(=C)C5=O)(OC3)O)O)C | ||
| InChI | 1S/C20H24O5/c1-10-11-4-5-12-18-9-25-20(24,19(12,8-11)15(10)22)16(23)14(18)17(2,3)7-6-13(18)21/h6-7,11-12,14,16,23-24H,1,4-5,8-9H2,2-3H3/t11-,12+,14-,16+,18-,19+,20-/m1/s1 | ||
| InChIKey | RTIKCEKESDRWAE-UJVKWQRCSA-N | ||
| CAS Number | 84745-95-9 | ||
| ChEMBL ID | CHEMBL2088267 | ||
| Structure | 
|
Download
2D
MOL
3D
MOL
|
|
| Chineses Pinyin | TuErFeng | ||
| Use Part | Tuber and whole herb | ||
| Flavor | Sweet; Slightly pungent | ||
| Meridian Tropism | Lung; liver; kidney | ||
| Species |
>Kingdom: Viridiplantae
-->Phylum: Streptophyta
-->Class: Equisetopsida
-->Order: Asterales
-->Family: Asteraceae
-->Genus: glabra
-->Species: Ainsliaea glabra
|
||
| Pair Name | Eriocalyxin B, Gemcitabine | |||
| Partner Name | Gemcitabine | |||
| Disease Info | [ICD-11: 2C10] | Pancreatic cancer | Investigative | |
| Biological Phenomena | Induction-->Apoptosis | |||
| Gene Regulation | Down-regulation | Phosphorylation | AKT1 | hsa207 |
| Up-regulation | Cleavage | CASP3 | hsa836 | |
| Up-regulation | Phosphorylation | MAPK8 | hsa5599 | |
| Down-regulation | Phosphorylation | NFKB1 | hsa4790 | |
| Up-regulation | Cleavage | PARP1 | hsa142 | |
| Down-regulation | Phosphorylation | PDK1 | hsa5163 | |
| In Vitro Model | PANC-1 | Pancreatic ductal adenocarcinoma | Homo sapiens (Human) | CVCL_0480 |
| SW1990 | Pancreatic adenocarcinoma | Homo sapiens (Human) | CVCL_1723 | |
| Capan-1 | Pancreatic ductal adenocarcinoma | Homo sapiens (Human) | CVCL_0237 | |
| Capan-2 | Pancreatic ductal adenocarcinoma | Homo sapiens (Human) | CVCL_0026 | |
| Result | Gem and EriB (or Isodon extract) taken together in combination regulated PDK1/AKT1/caspase and JNK signaling and promoted apoptosis synergistically, which may contribute to the much increased anti-proliferative activity compared to either agent alone. | |||
